C12H27N2O5P — CID 11120456
tert-butyl N-[3-(2-dimethoxyphosphorylethylamino)propyl]carbamate (PubChem CID 11120456) has the molecular formula C12H27N2O5P and a molecular weight of 310.33 g/mol. Its IUPAC name is tert-butyl N-[3-(2-dimethoxyphosphorylethylamino)propyl]carbamate.
| Compound Name | tert-butyl N-[3-(2-dimethoxyphosphorylethylamino)propyl]carbamate |
|---|---|
| PubChem CID | 11120456 |
| Molecular Formula | C12H27N2O5P |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | tert-butyl N-[3-(2-dimethoxyphosphorylethylamino)propyl]carbamate |
| SMILES | COP(=O)(CCNCCCNC(=O)OC(C)(C)C)OC |
| InChI | InChI=1S/C12H27N2O5P/c1-12(2,3)19-11(15)14-8-6-7-13-9-10-20(16,17-4)18-5/h13H,6-10H2,1-5H3,(H,14,15) |
| InChIKey | AZVYCBWSRVVPEI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|