C18H30N6 — CID 111205460
N'-methyl-N-[(4-methylcyclohexyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 111205460) has the molecular formula C18H30N6 and a molecular weight of 330.48 g/mol. Its IUPAC name is N'-methyl-N-[(4-methylcyclohexyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N'-methyl-N-[(4-methylcyclohexyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111205460 |
| Molecular Formula | C18H30N6 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.25 |
| IUPAC Name | N'-methyl-N-[(4-methylcyclohexyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC1CCC(C)CC1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C18H30N6/c1-15-4-6-16(7-5-15)14-22-17(19-2)23-10-12-24(13-11-23)18-20-8-3-9-21-18/h3,8-9,15-16H,4-7,10-14H2,1-2H3,(H,19,22) |
| InChIKey | MNKKCZNFBSEALS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|