C22H17ClN2O5S — CID 1112076
(5R)-4-[(4-chlorophenyl)-hydroxymethylidene]-5-(3-ethoxy-4-hydroxyphenyl)-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 1112076) has the molecular formula C22H17ClN2O5S and a molecular weight of 456.91 g/mol. Its IUPAC name is (5R)-4-[(4-chlorophenyl)-hydroxymethylidene]-5-(3-ethoxy-4-hydroxyphenyl)-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (5R)-4-[(4-chlorophenyl)-hydroxymethylidene]-5-(3-ethoxy-4-hydroxyphenyl)-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 1112076 |
| Molecular Formula | C22H17ClN2O5S |
| Molecular Weight | 456.91 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | (5R)-4-[(4-chlorophenyl)-hydroxymethylidene]-5-(3-ethoxy-4-hydroxyphenyl)-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | CCOc1cc([C@@H]2C(=C(O)c3ccc(Cl)cc3)C(=O)C(=O)N2c2nccs2)ccc1O |
| InChI | InChI=1S/C22H17ClN2O5S/c1-2-30-16-11-13(5-8-15(16)26)18-17(19(27)12-3-6-14(23)7-4-12)20(28)21(29)25(18)22-24-9-10-31-22/h3-11,18,26-27H,2H2,1H3/t18-/m1/s1 |
| InChIKey | RYRKFAWYKPKLHS-GOSISDBHSA-N |
| XLogP | 4.53 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.91 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|