C20H15ClN3O4S+ — CID 145494753
[4-[(3E)-3-[(4-chlorophenyl)-hydroxymethylidene]-4,5-dioxo-1-(1,3-thiazol-2-yl)pyrrolidin-2-yl]phenyl]-hydroxyazanium (PubChem CID 145494753) has the molecular formula C20H15ClN3O4S+ and a molecular weight of 428.88 g/mol. Its IUPAC name is [4-[(3E)-3-[(4-chlorophenyl)-hydroxymethylidene]-4,5-dioxo-1-(1,3-thiazol-2-yl)pyrrolidin-2-yl]phenyl]-hydroxyazanium.
| Compound Name | [4-[(3E)-3-[(4-chlorophenyl)-hydroxymethylidene]-4,5-dioxo-1-(1,3-thiazol-2-yl)pyrrolidin-2-yl]phenyl]-hydroxyazanium |
|---|---|
| PubChem CID | 145494753 |
| Molecular Formula | C20H15ClN3O4S+ |
| Molecular Weight | 428.88 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | [4-[(3E)-3-[(4-chlorophenyl)-hydroxymethylidene]-4,5-dioxo-1-(1,3-thiazol-2-yl)pyrrolidin-2-yl]phenyl]-hydroxyazanium |
| SMILES | O=C1C(=O)N(c2nccs2)C(c2ccc([NH2+]O)cc2)/C1=C(\O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H14ClN3O4S/c21-13-5-1-12(2-6-13)17(25)15-16(11-3-7-14(23-28)8-4-11)24(19(27)18(15)26)20-22-9-10-29-20/h1-10,16,23,25,28H/p+1/b17-15+ |
| InChIKey | UDXZPWLRJAJKDR-BMRADRMJSA-O |
| XLogP | 3.01 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.88 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|