C20H12Cl2N2O3S — CID 41201572
(5R)-5-(2-chlorophenyl)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 41201572) has the molecular formula C20H12Cl2N2O3S and a molecular weight of 431.30 g/mol. Its IUPAC name is (5R)-5-(2-chlorophenyl)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (5R)-5-(2-chlorophenyl)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 41201572 |
| Molecular Formula | C20H12Cl2N2O3S |
| Molecular Weight | 431.30 g/mol |
| Exact Mass | 429.99 |
| IUPAC Name | (5R)-5-(2-chlorophenyl)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2nccs2)[C@@H](c2ccccc2Cl)C1=C(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H12Cl2N2O3S/c21-12-7-5-11(6-8-12)17(25)15-16(13-3-1-2-4-14(13)22)24(19(27)18(15)26)20-23-9-10-28-20/h1-10,16,25H/t16-/m0/s1 |
| InChIKey | GKICQFIRNIQVTN-INIZCTEOSA-N |
| XLogP | 5.08 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.30 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|