C20H12ClN3O5S — CID 2868977
4-[(4-chlorophenyl)-hydroxymethylidene]-5-(4-nitrophenyl)-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 2868977) has the molecular formula C20H12ClN3O5S and a molecular weight of 441.85 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)-hydroxymethylidene]-5-(4-nitrophenyl)-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | 4-[(4-chlorophenyl)-hydroxymethylidene]-5-(4-nitrophenyl)-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 2868977 |
| Molecular Formula | C20H12ClN3O5S |
| Molecular Weight | 441.85 g/mol |
| Exact Mass | 441.02 |
| IUPAC Name | 4-[(4-chlorophenyl)-hydroxymethylidene]-5-(4-nitrophenyl)-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2nccs2)C(c2ccc([N+](=O)[O-])cc2)C1=C(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H12ClN3O5S/c21-13-5-1-12(2-6-13)17(25)15-16(11-3-7-14(8-4-11)24(28)29)23(19(27)18(15)26)20-22-9-10-30-20/h1-10,16,25H |
| InChIKey | AAXOEUBLXOIDFM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.85 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|