C20H12N4O7S — CID 41039674
(5S)-4-[hydroxy-(4-nitrophenyl)methylidene]-5-(4-nitrophenyl)-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 41039674) has the molecular formula C20H12N4O7S and a molecular weight of 452.40 g/mol. Its IUPAC name is (5S)-4-[hydroxy-(4-nitrophenyl)methylidene]-5-(4-nitrophenyl)-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (5S)-4-[hydroxy-(4-nitrophenyl)methylidene]-5-(4-nitrophenyl)-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 41039674 |
| Molecular Formula | C20H12N4O7S |
| Molecular Weight | 452.40 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | (5S)-4-[hydroxy-(4-nitrophenyl)methylidene]-5-(4-nitrophenyl)-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2nccs2)[C@@H](c2ccc([N+](=O)[O-])cc2)C1=C(O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H12N4O7S/c25-17(12-3-7-14(8-4-12)24(30)31)15-16(11-1-5-13(6-2-11)23(28)29)22(19(27)18(15)26)20-21-9-10-32-20/h1-10,16,25H/t16-/m0/s1 |
| InChIKey | QDDRWTSUOOCLLI-INIZCTEOSA-N |
| XLogP | 3.59 |
| TPSA | 156.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|