C15H31FO4Si — CID 11120846
[3-[ditert-butyl(fluoro)silyl]oxy-5-hydroxypentyl] acetate (PubChem CID 11120846) has the molecular formula C15H31FO4Si and a molecular weight of 322.49 g/mol. Its IUPAC name is [3-[ditert-butyl(fluoro)silyl]oxy-5-hydroxypentyl] acetate.
| Compound Name | [3-[ditert-butyl(fluoro)silyl]oxy-5-hydroxypentyl] acetate |
|---|---|
| PubChem CID | 11120846 |
| Molecular Formula | C15H31FO4Si |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | [3-[ditert-butyl(fluoro)silyl]oxy-5-hydroxypentyl] acetate |
| SMILES | CC(=O)OCCC(CCO)O[Si](F)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H31FO4Si/c1-12(18)19-11-9-13(8-10-17)20-21(16,14(2,3)4)15(5,6)7/h13,17H,8-11H2,1-7H3 |
| InChIKey | YSFFDYJTWSTDEH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|