C16H29F3IN3O — CID 111208822
1-[2-(cyclohexen-1-yl)ethyl]-3-ethyl-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide (PubChem CID 111208822) has the molecular formula C16H29F3IN3O and a molecular weight of 463.33 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-3-ethyl-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-ethyl-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111208822 |
| Molecular Formula | C16H29F3IN3O |
| Molecular Weight | 463.33 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-ethyl-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCOCC(F)(F)F)NCCC1=CCCCC1.I |
| InChI | InChI=1S/C16H28F3N3O.HI/c1-2-20-15(21-10-6-12-23-13-16(17,18)19)22-11-9-14-7-4-3-5-8-14;/h7H,2-6,8-13H2,1H3,(H2,20,21,22);1H |
| InChIKey | CIDRMJFNDDLTPF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|