C14H24F3N3 — CID 111778451
1-[2-(cyclohexen-1-yl)ethyl]-3-ethyl-2-(3,3,3-trifluoropropyl)guanidine (PubChem CID 111778451) has the molecular formula C14H24F3N3 and a molecular weight of 291.36 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-3-ethyl-2-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-ethyl-2-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 111778451 |
| Molecular Formula | C14H24F3N3 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-ethyl-2-(3,3,3-trifluoropropyl)guanidine |
| SMILES | CCN/C(=N\CCC(F)(F)F)NCCC1=CCCCC1 |
| InChI | InChI=1S/C14H24F3N3/c1-2-18-13(20-11-9-14(15,16)17)19-10-8-12-6-4-3-5-7-12/h6H,2-5,7-11H2,1H3,(H2,18,19,20) |
| InChIKey | RMXHQPWQQVBPFO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|