C17H29F3N4 — CID 111209108
2-[2-(cyclohexen-1-yl)ethyl]-1-ethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine (PubChem CID 111209108) has the molecular formula C17H29F3N4 and a molecular weight of 346.44 g/mol. Its IUPAC name is 2-[2-(cyclohexen-1-yl)ethyl]-1-ethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine.
| Compound Name | 2-[2-(cyclohexen-1-yl)ethyl]-1-ethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111209108 |
| Molecular Formula | C17H29F3N4 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 2-[2-(cyclohexen-1-yl)ethyl]-1-ethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
| SMILES | CCN/C(=N\CCC1=CCCCC1)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C17H29F3N4/c1-2-21-16(22-10-8-14-6-4-3-5-7-14)23-15-9-11-24(12-15)13-17(18,19)20/h6,15H,2-5,7-13H2,1H3,(H2,21,22,23) |
| InChIKey | JVOSZOUKFHFEIA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|