C16H29F3N4 — CID 111209156
1-[2-(cyclohexen-1-yl)ethyl]-2-methyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine (PubChem CID 111209156) has the molecular formula C16H29F3N4 and a molecular weight of 334.43 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-2-methyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-2-methyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine |
|---|---|
| PubChem CID | 111209156 |
| Molecular Formula | C16H29F3N4 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-2-methyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine |
| SMILES | C/N=C(\NCCCN(C)CC(F)(F)F)NCCC1=CCCCC1 |
| InChI | InChI=1S/C16H29F3N4/c1-20-15(22-11-9-14-7-4-3-5-8-14)21-10-6-12-23(2)13-16(17,18)19/h7H,3-6,8-13H2,1-2H3,(H2,20,21,22) |
| InChIKey | YPXSQTVZJQSMOV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|