C20H32IN3O — CID 111209587
1-[2-(cyclohexen-1-yl)ethyl]-3-[[4-(ethoxymethyl)phenyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 111209587) has the molecular formula C20H32IN3O and a molecular weight of 457.40 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-3-[[4-(ethoxymethyl)phenyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-[[4-(ethoxymethyl)phenyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111209587 |
| Molecular Formula | C20H32IN3O |
| Molecular Weight | 457.40 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-[[4-(ethoxymethyl)phenyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCOCc1ccc(CN/C(=N/C)NCCC2=CCCCC2)cc1.I |
| InChI | InChI=1S/C20H31N3O.HI/c1-3-24-16-19-11-9-18(10-12-19)15-23-20(21-2)22-14-13-17-7-5-4-6-8-17;/h7,9-12H,3-6,8,13-16H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | OYHWQNMMLZQRFJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.40 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|