C21H33N3O3 — CID 111208921
1-[2-(cyclohexen-1-yl)ethyl]-3-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-methylguanidine (PubChem CID 111208921) has the molecular formula C21H33N3O3 and a molecular weight of 375.51 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-3-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-methylguanidine.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111208921 |
| Molecular Formula | C21H33N3O3 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.25 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-methylguanidine |
| SMILES | CCOc1c(OC)cc(CN/C(=N/C)NCCC2=CCCCC2)cc1OC |
| InChI | InChI=1S/C21H33N3O3/c1-5-27-20-18(25-3)13-17(14-19(20)26-4)15-24-21(22-2)23-12-11-16-9-7-6-8-10-16/h9,13-14H,5-8,10-12,15H2,1-4H3,(H2,22,23,24) |
| InChIKey | WVXHWOBPEOSDQH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|