C23H27NO — CID 11121169
(1R,2S)-2-(benzhydrylideneamino)-1-cyclohexylbut-3-en-1-ol (PubChem CID 11121169) has the molecular formula C23H27NO and a molecular weight of 333.48 g/mol. Its IUPAC name is (1R,2S)-2-(benzhydrylideneamino)-1-cyclohexylbut-3-en-1-ol.
| Compound Name | (1R,2S)-2-(benzhydrylideneamino)-1-cyclohexylbut-3-en-1-ol |
|---|---|
| PubChem CID | 11121169 |
| Molecular Formula | C23H27NO |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | (1R,2S)-2-(benzhydrylideneamino)-1-cyclohexylbut-3-en-1-ol |
| SMILES | C=C[C@H](N=C(c1ccccc1)c1ccccc1)[C@H](O)C1CCCCC1 |
| InChI | InChI=1S/C23H27NO/c1-2-21(23(25)20-16-10-5-11-17-20)24-22(18-12-6-3-7-13-18)19-14-8-4-9-15-19/h2-4,6-9,12-15,20-21,23,25H,1,5,10-11,16-17H2/t21-,23+/m0/s1 |
| InChIKey | APNGERZVHAQNSQ-JTHBVZDNSA-N |
| XLogP | 5.02 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|