C17H31IN4O2 — CID 111212404
N-[2-[(N'-methyl-N-octan-2-ylcarbamimidoyl)amino]ethyl]furan-2-carboxamide;hydroiodide (PubChem CID 111212404) has the molecular formula C17H31IN4O2 and a molecular weight of 450.37 g/mol. Its IUPAC name is N-[2-[(N'-methyl-N-octan-2-ylcarbamimidoyl)amino]ethyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[2-[(N'-methyl-N-octan-2-ylcarbamimidoyl)amino]ethyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111212404 |
| Molecular Formula | C17H31IN4O2 |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | N-[2-[(N'-methyl-N-octan-2-ylcarbamimidoyl)amino]ethyl]furan-2-carboxamide;hydroiodide |
| SMILES | CCCCCCC(C)N/C(=N\C)NCCNC(=O)c1ccco1.I |
| InChI | InChI=1S/C17H30N4O2.HI/c1-4-5-6-7-9-14(2)21-17(18-3)20-12-11-19-16(22)15-10-8-13-23-15;/h8,10,13-14H,4-7,9,11-12H2,1-3H3,(H,19,22)(H2,18,20,21);1H |
| InChIKey | TWUMBMMMTLNAHM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|