C15H33IN4O — CID 111195269
N-[2-[(N-heptan-2-yl-N'-methylcarbamimidoyl)amino]ethyl]-2-methylpropanamide;hydroiodide (PubChem CID 111195269) has the molecular formula C15H33IN4O and a molecular weight of 412.36 g/mol. Its IUPAC name is N-[2-[(N-heptan-2-yl-N'-methylcarbamimidoyl)amino]ethyl]-2-methylpropanamide;hydroiodide.
| Compound Name | N-[2-[(N-heptan-2-yl-N'-methylcarbamimidoyl)amino]ethyl]-2-methylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111195269 |
| Molecular Formula | C15H33IN4O |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | N-[2-[(N-heptan-2-yl-N'-methylcarbamimidoyl)amino]ethyl]-2-methylpropanamide;hydroiodide |
| SMILES | CCCCCC(C)N/C(=N/C)NCCNC(=O)C(C)C.I |
| InChI | InChI=1S/C15H32N4O.HI/c1-6-7-8-9-13(4)19-15(16-5)18-11-10-17-14(20)12(2)3;/h12-13H,6-11H2,1-5H3,(H,17,20)(H2,16,18,19);1H |
| InChIKey | PCRCFJRUPTYEDT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|