C13H29N3 — CID 111212541
2-methyl-1-octan-2-yl-3-propylguanidine (PubChem CID 111212541) has the molecular formula C13H29N3 and a molecular weight of 227.40 g/mol. Its IUPAC name is 2-methyl-1-octan-2-yl-3-propylguanidine.
| Compound Name | 2-methyl-1-octan-2-yl-3-propylguanidine |
|---|---|
| PubChem CID | 111212541 |
| Molecular Formula | C13H29N3 |
| Molecular Weight | 227.40 g/mol |
| Exact Mass | 227.24 |
| IUPAC Name | 2-methyl-1-octan-2-yl-3-propylguanidine |
| SMILES | CCCCCCC(C)N/C(=N/C)NCCC |
| InChI | InChI=1S/C13H29N3/c1-5-7-8-9-10-12(3)16-13(14-4)15-11-6-2/h12H,5-11H2,1-4H3,(H2,14,15,16) |
| InChIKey | WPAQFIDEXUTAHN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|