C14H31IN4O — CID 111195279
2-[(N-heptan-2-yl-N'-methylcarbamimidoyl)amino]-N-propylacetamide;hydroiodide (PubChem CID 111195279) has the molecular formula C14H31IN4O and a molecular weight of 398.33 g/mol. Its IUPAC name is 2-[(N-heptan-2-yl-N'-methylcarbamimidoyl)amino]-N-propylacetamide;hydroiodide.
| Compound Name | 2-[(N-heptan-2-yl-N'-methylcarbamimidoyl)amino]-N-propylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111195279 |
| Molecular Formula | C14H31IN4O |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 2-[(N-heptan-2-yl-N'-methylcarbamimidoyl)amino]-N-propylacetamide;hydroiodide |
| SMILES | CCCCCC(C)N/C(=N/C)NCC(=O)NCCC.I |
| InChI | InChI=1S/C14H30N4O.HI/c1-5-7-8-9-12(3)18-14(15-4)17-11-13(19)16-10-6-2;/h12H,5-11H2,1-4H3,(H,16,19)(H2,15,17,18);1H |
| InChIKey | QGVUOFVXEJLGCE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|