C15H32N4O2 — CID 111212331
N-(2-methoxyethyl)-2-[(N'-methyl-N-octan-2-ylcarbamimidoyl)amino]acetamide (PubChem CID 111212331) has the molecular formula C15H32N4O2 and a molecular weight of 300.45 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[(N'-methyl-N-octan-2-ylcarbamimidoyl)amino]acetamide.
| Compound Name | N-(2-methoxyethyl)-2-[(N'-methyl-N-octan-2-ylcarbamimidoyl)amino]acetamide |
|---|---|
| PubChem CID | 111212331 |
| Molecular Formula | C15H32N4O2 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | N-(2-methoxyethyl)-2-[(N'-methyl-N-octan-2-ylcarbamimidoyl)amino]acetamide |
| SMILES | CCCCCCC(C)N/C(=N/C)NCC(=O)NCCOC |
| InChI | InChI=1S/C15H32N4O2/c1-5-6-7-8-9-13(2)19-15(16-3)18-12-14(20)17-10-11-21-4/h13H,5-12H2,1-4H3,(H,17,20)(H2,16,18,19) |
| InChIKey | UIWNKWGKMTUQTM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|