C16H35N5O2 — CID 110999827
2-[[N-[5-(diethylamino)pentan-2-yl]-N'-methylcarbamimidoyl]amino]-N-(2-methoxyethyl)acetamide (PubChem CID 110999827) has the molecular formula C16H35N5O2 and a molecular weight of 329.49 g/mol. Its IUPAC name is 2-[[N-[5-(diethylamino)pentan-2-yl]-N'-methylcarbamimidoyl]amino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[[N-[5-(diethylamino)pentan-2-yl]-N'-methylcarbamimidoyl]amino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 110999827 |
| Molecular Formula | C16H35N5O2 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.28 |
| IUPAC Name | 2-[[N-[5-(diethylamino)pentan-2-yl]-N'-methylcarbamimidoyl]amino]-N-(2-methoxyethyl)acetamide |
| SMILES | CCN(CC)CCCC(C)N/C(=N/C)NCC(=O)NCCOC |
| InChI | InChI=1S/C16H35N5O2/c1-6-21(7-2)11-8-9-14(3)20-16(17-4)19-13-15(22)18-10-12-23-5/h14H,6-13H2,1-5H3,(H,18,22)(H2,17,19,20) |
| InChIKey | GECTVVYOCOQIPA-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|