C21H39IN4O2S — CID 111212500
2-methyl-1-octan-2-yl-3-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111212500) has the molecular formula C21H39IN4O2S and a molecular weight of 538.54 g/mol. Its IUPAC name is 2-methyl-1-octan-2-yl-3-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-octan-2-yl-3-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111212500 |
| Molecular Formula | C21H39IN4O2S |
| Molecular Weight | 538.54 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | 2-methyl-1-octan-2-yl-3-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCCCCCC(C)N/C(=N\C)NCc1ccccc1CS(=O)(=O)NC(C)C.I |
| InChI | InChI=1S/C21H38N4O2S.HI/c1-6-7-8-9-12-18(4)24-21(22-5)23-15-19-13-10-11-14-20(19)16-28(26,27)25-17(2)3;/h10-11,13-14,17-18,25H,6-9,12,15-16H2,1-5H3,(H2,22,23,24);1H |
| InChIKey | SJNTWDMFKBBBKX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.54 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|