C21H30FIN4O2S — CID 111361890
1-[2-(2-fluorophenyl)ethyl]-2-methyl-3-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111361890) has the molecular formula C21H30FIN4O2S and a molecular weight of 548.47 g/mol. Its IUPAC name is 1-[2-(2-fluorophenyl)ethyl]-2-methyl-3-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(2-fluorophenyl)ethyl]-2-methyl-3-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111361890 |
| Molecular Formula | C21H30FIN4O2S |
| Molecular Weight | 548.47 g/mol |
| Exact Mass | 548.11 |
| IUPAC Name | 1-[2-(2-fluorophenyl)ethyl]-2-methyl-3-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccccc1F)NCc1ccccc1CS(=O)(=O)NC(C)C.I |
| InChI | InChI=1S/C21H29FN4O2S.HI/c1-16(2)26-29(27,28)15-19-10-5-4-9-18(19)14-25-21(23-3)24-13-12-17-8-6-7-11-20(17)22;/h4-11,16,26H,12-15H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | RTPQKELAWJCMJX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|