C22H39N5O2S — CID 111324778
1-[3-(azepan-1-yl)propyl]-2-methyl-3-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine (PubChem CID 111324778) has the molecular formula C22H39N5O2S and a molecular weight of 437.65 g/mol. Its IUPAC name is 1-[3-(azepan-1-yl)propyl]-2-methyl-3-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[3-(azepan-1-yl)propyl]-2-methyl-3-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111324778 |
| Molecular Formula | C22H39N5O2S |
| Molecular Weight | 437.65 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | 1-[3-(azepan-1-yl)propyl]-2-methyl-3-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(/NCCCN1CCCCCC1)NCc1ccccc1CS(=O)(=O)NC(C)C |
| InChI | InChI=1S/C22H39N5O2S/c1-19(2)26-30(28,29)18-21-12-7-6-11-20(21)17-25-22(23-3)24-13-10-16-27-14-8-4-5-9-15-27/h6-7,11-12,19,26H,4-5,8-10,13-18H2,1-3H3,(H2,23,24,25) |
| InChIKey | XNRVBXBQUMRYDU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.65 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|