C17H28N4O2S — CID 110934317
N'-methyl-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]pyrrolidine-1-carboximidamide (PubChem CID 110934317) has the molecular formula C17H28N4O2S and a molecular weight of 352.50 g/mol. Its IUPAC name is N'-methyl-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]pyrrolidine-1-carboximidamide.
| Compound Name | N'-methyl-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 110934317 |
| Molecular Formula | C17H28N4O2S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | N'-methyl-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCc1ccccc1CS(=O)(=O)NC(C)C)N1CCCC1 |
| InChI | InChI=1S/C17H28N4O2S/c1-14(2)20-24(22,23)13-16-9-5-4-8-15(16)12-19-17(18-3)21-10-6-7-11-21/h4-5,8-9,14,20H,6-7,10-13H2,1-3H3,(H,18,19) |
| InChIKey | IEVPSVVPTDNEMI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|