C21H36N4O2S — CID 111734097
N'-methyl-3-(2-methylpropyl)-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]pyrrolidine-1-carboximidamide (PubChem CID 111734097) has the molecular formula C21H36N4O2S and a molecular weight of 408.61 g/mol. Its IUPAC name is N'-methyl-3-(2-methylpropyl)-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]pyrrolidine-1-carboximidamide.
| Compound Name | N'-methyl-3-(2-methylpropyl)-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111734097 |
| Molecular Formula | C21H36N4O2S |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | N'-methyl-3-(2-methylpropyl)-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCc1ccccc1CS(=O)(=O)NC(C)C)N1CCC(CC(C)C)C1 |
| InChI | InChI=1S/C21H36N4O2S/c1-16(2)12-18-10-11-25(14-18)21(22-5)23-13-19-8-6-7-9-20(19)15-28(26,27)24-17(3)4/h6-9,16-18,24H,10-15H2,1-5H3,(H,22,23) |
| InChIKey | JSXCJRZYTVCZPU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|