C22H34N4O — CID 111734309
N'-methyl-3-(2-methylpropyl)-N-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]pyrrolidine-1-carboximidamide (PubChem CID 111734309) has the molecular formula C22H34N4O and a molecular weight of 370.54 g/mol. Its IUPAC name is N'-methyl-3-(2-methylpropyl)-N-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]pyrrolidine-1-carboximidamide.
| Compound Name | N'-methyl-3-(2-methylpropyl)-N-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111734309 |
| Molecular Formula | C22H34N4O |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | N'-methyl-3-(2-methylpropyl)-N-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCc1ccccc1CN1CCCC1=O)N1CCC(CC(C)C)C1 |
| InChI | InChI=1S/C22H34N4O/c1-17(2)13-18-10-12-26(15-18)22(23-3)24-14-19-7-4-5-8-20(19)16-25-11-6-9-21(25)27/h4-5,7-8,17-18H,6,9-16H2,1-3H3,(H,23,24) |
| InChIKey | IXPUUXCHIACQEL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|