C25H36IN3O3 — CID 111214550
1-[2-(3,4-dimethoxyphenyl)ethyl]-3-ethyl-2-[(2-phenyloxan-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111214550) has the molecular formula C25H36IN3O3 and a molecular weight of 553.49 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-ethyl-2-[(2-phenyloxan-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-ethyl-2-[(2-phenyloxan-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111214550 |
| Molecular Formula | C25H36IN3O3 |
| Molecular Weight | 553.49 g/mol |
| Exact Mass | 553.18 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-ethyl-2-[(2-phenyloxan-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CCCOC1c1ccccc1)NCCc1ccc(OC)c(OC)c1.I |
| InChI | InChI=1S/C25H35N3O3.HI/c1-4-26-25(27-15-14-19-12-13-22(29-2)23(17-19)30-3)28-18-21-11-8-16-31-24(21)20-9-6-5-7-10-20;/h5-7,9-10,12-13,17,21,24H,4,8,11,14-16,18H2,1-3H3,(H2,26,27,28);1H |
| InChIKey | ALXJRQWLAXKGHH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|