C20H35NO2Si — CID 11121645
tert-butyl-dimethyl-[(2R)-2-phenylmethoxy-2-[(2S)-pyrrolidin-2-yl]propoxy]silane (PubChem CID 11121645) has the molecular formula C20H35NO2Si and a molecular weight of 349.59 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2R)-2-phenylmethoxy-2-[(2S)-pyrrolidin-2-yl]propoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(2R)-2-phenylmethoxy-2-[(2S)-pyrrolidin-2-yl]propoxy]silane |
|---|---|
| PubChem CID | 11121645 |
| Molecular Formula | C20H35NO2Si |
| Molecular Weight | 349.59 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | tert-butyl-dimethyl-[(2R)-2-phenylmethoxy-2-[(2S)-pyrrolidin-2-yl]propoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@](C)(OCc1ccccc1)[C@@H]1CCCN1 |
| InChI | InChI=1S/C20H35NO2Si/c1-19(2,3)24(5,6)23-16-20(4,18-13-10-14-21-18)22-15-17-11-8-7-9-12-17/h7-9,11-12,18,21H,10,13-16H2,1-6H3/t18-,20-/m0/s1 |
| InChIKey | FWTOFLWDEZRSNX-ICSRJNTNSA-N |
| XLogP | 4.74 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.59 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|