C21H25IN4O3 — CID 111216628
1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-ethyl-2-[(2-methoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111216628) has the molecular formula C21H25IN4O3 and a molecular weight of 508.36 g/mol. Its IUPAC name is 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-ethyl-2-[(2-methoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-ethyl-2-[(2-methoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111216628 |
| Molecular Formula | C21H25IN4O3 |
| Molecular Weight | 508.36 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-ethyl-2-[(2-methoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1OC)NCCN1C(=O)c2ccccc2C1=O.I |
| InChI | InChI=1S/C21H24N4O3.HI/c1-3-22-21(24-14-15-8-4-7-11-18(15)28-2)23-12-13-25-19(26)16-9-5-6-10-17(16)20(25)27;/h4-11H,3,12-14H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | XUWWICMPBJKWRS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|