C20H21ClN4O2 — CID 111130808
2-[(4-chlorophenyl)methyl]-1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-ethylguanidine (PubChem CID 111130808) has the molecular formula C20H21ClN4O2 and a molecular weight of 384.87 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl]-1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-ethylguanidine.
| Compound Name | 2-[(4-chlorophenyl)methyl]-1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111130808 |
| Molecular Formula | C20H21ClN4O2 |
| Molecular Weight | 384.87 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl]-1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1ccc(Cl)cc1)NCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H21ClN4O2/c1-2-22-20(24-13-14-7-9-15(21)10-8-14)23-11-12-25-18(26)16-5-3-4-6-17(16)19(25)27/h3-10H,2,11-13H2,1H3,(H2,22,23,24) |
| InChIKey | ZHFGSONVWZFDTK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.87 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|