C13H29IN4O2 — CID 111222698
3-[[N-(3-ethoxypropyl)-N'-methylcarbamimidoyl]amino]-N-propan-2-ylpropanamide;hydroiodide (PubChem CID 111222698) has the molecular formula C13H29IN4O2 and a molecular weight of 400.31 g/mol. Its IUPAC name is 3-[[N-(3-ethoxypropyl)-N'-methylcarbamimidoyl]amino]-N-propan-2-ylpropanamide;hydroiodide.
| Compound Name | 3-[[N-(3-ethoxypropyl)-N'-methylcarbamimidoyl]amino]-N-propan-2-ylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111222698 |
| Molecular Formula | C13H29IN4O2 |
| Molecular Weight | 400.31 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 3-[[N-(3-ethoxypropyl)-N'-methylcarbamimidoyl]amino]-N-propan-2-ylpropanamide;hydroiodide |
| SMILES | CCOCCCN/C(=N\C)NCCC(=O)NC(C)C.I |
| InChI | InChI=1S/C13H28N4O2.HI/c1-5-19-10-6-8-15-13(14-4)16-9-7-12(18)17-11(2)3;/h11H,5-10H2,1-4H3,(H,17,18)(H2,14,15,16);1H |
| InChIKey | KQSBHARIYPPZOI-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|