C20H32IN5O — CID 111223650
1-[2-(1-benzylimidazol-2-yl)ethyl]-2-(3-ethoxypropyl)-3-ethylguanidine;hydroiodide (PubChem CID 111223650) has the molecular formula C20H32IN5O and a molecular weight of 485.41 g/mol. Its IUPAC name is 1-[2-(1-benzylimidazol-2-yl)ethyl]-2-(3-ethoxypropyl)-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[2-(1-benzylimidazol-2-yl)ethyl]-2-(3-ethoxypropyl)-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111223650 |
| Molecular Formula | C20H32IN5O |
| Molecular Weight | 485.41 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | 1-[2-(1-benzylimidazol-2-yl)ethyl]-2-(3-ethoxypropyl)-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCOCC)NCCc1nccn1Cc1ccccc1.I |
| InChI | InChI=1S/C20H31N5O.HI/c1-3-21-20(23-12-8-16-26-4-2)24-13-11-19-22-14-15-25(19)17-18-9-6-5-7-10-18;/h5-7,9-10,14-15H,3-4,8,11-13,16-17H2,1-2H3,(H2,21,23,24);1H |
| InChIKey | YLNSVBUKBREUSA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|