C21H34IN5O — CID 111794412
2-[(1-benzylimidazol-2-yl)methyl]-1-(3-butoxypropyl)-3-ethylguanidine;hydroiodide (PubChem CID 111794412) has the molecular formula C21H34IN5O and a molecular weight of 499.44 g/mol. Its IUPAC name is 2-[(1-benzylimidazol-2-yl)methyl]-1-(3-butoxypropyl)-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[(1-benzylimidazol-2-yl)methyl]-1-(3-butoxypropyl)-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111794412 |
| Molecular Formula | C21H34IN5O |
| Molecular Weight | 499.44 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | 2-[(1-benzylimidazol-2-yl)methyl]-1-(3-butoxypropyl)-3-ethylguanidine;hydroiodide |
| SMILES | CCCCOCCCN/C(=N/Cc1nccn1Cc1ccccc1)NCC.I |
| InChI | InChI=1S/C21H33N5O.HI/c1-3-5-15-27-16-9-12-24-21(22-4-2)25-17-20-23-13-14-26(20)18-19-10-7-6-8-11-19;/h6-8,10-11,13-14H,3-5,9,12,15-18H2,1-2H3,(H2,22,24,25);1H |
| InChIKey | RZGXQUQGJCKHNK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|