C15H25FN4O2S — CID 111230265
1-[3-(ethylsulfonylamino)propyl]-3-[2-(4-fluorophenyl)ethyl]-2-methylguanidine (PubChem CID 111230265) has the molecular formula C15H25FN4O2S and a molecular weight of 344.46 g/mol. Its IUPAC name is 1-[3-(ethylsulfonylamino)propyl]-3-[2-(4-fluorophenyl)ethyl]-2-methylguanidine.
| Compound Name | 1-[3-(ethylsulfonylamino)propyl]-3-[2-(4-fluorophenyl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111230265 |
| Molecular Formula | C15H25FN4O2S |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 1-[3-(ethylsulfonylamino)propyl]-3-[2-(4-fluorophenyl)ethyl]-2-methylguanidine |
| SMILES | CCS(=O)(=O)NCCCN/C(=N\C)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C15H25FN4O2S/c1-3-23(21,22)20-11-4-10-18-15(17-2)19-12-9-13-5-7-14(16)8-6-13/h5-8,20H,3-4,9-12H2,1-2H3,(H2,17,18,19) |
| InChIKey | RMBJLVRDIRDVKE-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|