C17H29FN4 — CID 111230733
1-[3-(dimethylamino)-2,2-dimethylpropyl]-3-[2-(4-fluorophenyl)ethyl]-2-methylguanidine (PubChem CID 111230733) has the molecular formula C17H29FN4 and a molecular weight of 308.44 g/mol. Its IUPAC name is 1-[3-(dimethylamino)-2,2-dimethylpropyl]-3-[2-(4-fluorophenyl)ethyl]-2-methylguanidine.
| Compound Name | 1-[3-(dimethylamino)-2,2-dimethylpropyl]-3-[2-(4-fluorophenyl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111230733 |
| Molecular Formula | C17H29FN4 |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | 1-[3-(dimethylamino)-2,2-dimethylpropyl]-3-[2-(4-fluorophenyl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCc1ccc(F)cc1)NCC(C)(C)CN(C)C |
| InChI | InChI=1S/C17H29FN4/c1-17(2,13-22(4)5)12-21-16(19-3)20-11-10-14-6-8-15(18)9-7-14/h6-9H,10-13H2,1-5H3,(H2,19,20,21) |
| InChIKey | OXTIXHPGUVIEGK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|