C27H42IN5 — CID 111233702
1-(3,3-diphenylpropyl)-3-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-2-methylguanidine;hydroiodide (PubChem CID 111233702) has the molecular formula C27H42IN5 and a molecular weight of 563.57 g/mol. Its IUPAC name is 1-(3,3-diphenylpropyl)-3-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(3,3-diphenylpropyl)-3-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111233702 |
| Molecular Formula | C27H42IN5 |
| Molecular Weight | 563.57 g/mol |
| Exact Mass | 563.25 |
| IUPAC Name | 1-(3,3-diphenylpropyl)-3-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-2-methylguanidine;hydroiodide |
| SMILES | CCN1CCN(CC(C)CN/C(=N/C)NCCC(c2ccccc2)c2ccccc2)CC1.I |
| InChI | InChI=1S/C27H41N5.HI/c1-4-31-17-19-32(20-18-31)22-23(2)21-30-27(28-3)29-16-15-26(24-11-7-5-8-12-24)25-13-9-6-10-14-25;/h5-14,23,26H,4,15-22H2,1-3H3,(H2,28,29,30);1H |
| InChIKey | XKKXXOLOGJHTAE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.57 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|