C27H34NO4P — CID 11123489
(1R,2S)-2-(dibenzylamino)-1-diethoxyphosphoryl-3-phenylpropan-1-ol (PubChem CID 11123489) has the molecular formula C27H34NO4P and a molecular weight of 467.55 g/mol. Its IUPAC name is (1R,2S)-2-(dibenzylamino)-1-diethoxyphosphoryl-3-phenylpropan-1-ol.
| Compound Name | (1R,2S)-2-(dibenzylamino)-1-diethoxyphosphoryl-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 11123489 |
| Molecular Formula | C27H34NO4P |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | (1R,2S)-2-(dibenzylamino)-1-diethoxyphosphoryl-3-phenylpropan-1-ol |
| SMILES | CCOP(=O)(OCC)[C@@H](O)[C@H](Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C27H34NO4P/c1-3-31-33(30,32-4-2)27(29)26(20-23-14-8-5-9-15-23)28(21-24-16-10-6-11-17-24)22-25-18-12-7-13-19-25/h5-19,26-27,29H,3-4,20-22H2,1-2H3/t26-,27+/m0/s1 |
| InChIKey | ITQKBZQCDFEVAS-RRPNLBNLSA-N |
| XLogP | 5.88 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|