C29H24N4O3 — CID 11123617
1-(1,3-benzodioxol-5-yl)-2-[5-(4-methoxyphenyl)pyrimidin-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 11123617) has the molecular formula C29H24N4O3 and a molecular weight of 476.54 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-[5-(4-methoxyphenyl)pyrimidin-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-[5-(4-methoxyphenyl)pyrimidin-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 11123617 |
| Molecular Formula | C29H24N4O3 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-[5-(4-methoxyphenyl)pyrimidin-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | COc1ccc(-c2cnc(N3CCc4c([nH]c5ccccc45)C3c3ccc4c(c3)OCO4)nc2)cc1 |
| InChI | InChI=1S/C29H24N4O3/c1-34-21-9-6-18(7-10-21)20-15-30-29(31-16-20)33-13-12-23-22-4-2-3-5-24(22)32-27(23)28(33)19-8-11-25-26(14-19)36-17-35-25/h2-11,14-16,28,32H,12-13,17H2,1H3 |
| InChIKey | KVVNILHEEWTMAQ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 72.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|