C25H29ClN6O2 — CID 11123677
N-[(4-carbamimidoylphenyl)methyl]-2-[5-chloro-2-oxo-3-(pentan-3-ylamino)-6-phenylpyrazin-1-yl]acetamide (PubChem CID 11123677) has the molecular formula C25H29ClN6O2 and a molecular weight of 481.00 g/mol. Its IUPAC name is N-[(4-carbamimidoylphenyl)methyl]-2-[5-chloro-2-oxo-3-(pentan-3-ylamino)-6-phenylpyrazin-1-yl]acetamide.
| Compound Name | N-[(4-carbamimidoylphenyl)methyl]-2-[5-chloro-2-oxo-3-(pentan-3-ylamino)-6-phenylpyrazin-1-yl]acetamide |
|---|---|
| PubChem CID | 11123677 |
| Molecular Formula | C25H29ClN6O2 |
| Molecular Weight | 481.00 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | N-[(4-carbamimidoylphenyl)methyl]-2-[5-chloro-2-oxo-3-(pentan-3-ylamino)-6-phenylpyrazin-1-yl]acetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)Cn2c(-c3ccccc3)c(Cl)nc(NC(CC)CC)c2=O)cc1 |
| InChI | InChI=1S/C25H29ClN6O2/c1-3-19(4-2)30-24-25(34)32(21(22(26)31-24)17-8-6-5-7-9-17)15-20(33)29-14-16-10-12-18(13-11-16)23(27)28/h5-13,19H,3-4,14-15H2,1-2H3,(H3,27,28)(H,29,33)(H,30,31) |
| InChIKey | MMGHHQMLYUHLGS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 125.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.00 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|