C20H35N3O3 — CID 111238693
1-(3-butoxypropyl)-3-ethyl-2-(2-hydroxy-3-phenylmethoxypropyl)guanidine (PubChem CID 111238693) has the molecular formula C20H35N3O3 and a molecular weight of 365.52 g/mol. Its IUPAC name is 1-(3-butoxypropyl)-3-ethyl-2-(2-hydroxy-3-phenylmethoxypropyl)guanidine.
| Compound Name | 1-(3-butoxypropyl)-3-ethyl-2-(2-hydroxy-3-phenylmethoxypropyl)guanidine |
|---|---|
| PubChem CID | 111238693 |
| Molecular Formula | C20H35N3O3 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.27 |
| IUPAC Name | 1-(3-butoxypropyl)-3-ethyl-2-(2-hydroxy-3-phenylmethoxypropyl)guanidine |
| SMILES | CCCCOCCCN/C(=N/CC(O)COCc1ccccc1)NCC |
| InChI | InChI=1S/C20H35N3O3/c1-3-5-13-25-14-9-12-22-20(21-4-2)23-15-19(24)17-26-16-18-10-7-6-8-11-18/h6-8,10-11,19,24H,3-5,9,12-17H2,1-2H3,(H2,21,22,23) |
| InChIKey | DYBVUUVBUPQPHS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|