C16H22Br2O8 — CID 11123969
bis(3-methoxy-2,2-dimethyl-3-oxopropyl) (E)-2,3-dibromobut-2-enedioate (PubChem CID 11123969) has the molecular formula C16H22Br2O8 and a molecular weight of 502.15 g/mol. Its IUPAC name is bis(3-methoxy-2,2-dimethyl-3-oxopropyl) (E)-2,3-dibromobut-2-enedioate.
| Compound Name | bis(3-methoxy-2,2-dimethyl-3-oxopropyl) (E)-2,3-dibromobut-2-enedioate |
|---|---|
| PubChem CID | 11123969 |
| Molecular Formula | C16H22Br2O8 |
| Molecular Weight | 502.15 g/mol |
| Exact Mass | 499.97 |
| IUPAC Name | bis(3-methoxy-2,2-dimethyl-3-oxopropyl) (E)-2,3-dibromobut-2-enedioate |
| SMILES | COC(=O)C(C)(C)COC(=O)/C(Br)=C(\Br)C(=O)OCC(C)(C)C(=O)OC |
| InChI | InChI=1S/C16H22Br2O8/c1-15(2,13(21)23-5)7-25-11(19)9(17)10(18)12(20)26-8-16(3,4)14(22)24-6/h7-8H2,1-6H3/b10-9+ |
| InChIKey | GEHWIZPGKNGVED-MDZDMXLPSA-N |
| XLogP | 2.47 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.15 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|