C8H8Br2O6 — CID 11024798
4-O-(2-methoxy-2-oxoethyl) 1-O-methyl (E)-2,3-dibromobut-2-enedioate (PubChem CID 11024798) has the molecular formula C8H8Br2O6 and a molecular weight of 359.95 g/mol. Its IUPAC name is 4-O-(2-methoxy-2-oxoethyl) 1-O-methyl (E)-2,3-dibromobut-2-enedioate.
| Compound Name | 4-O-(2-methoxy-2-oxoethyl) 1-O-methyl (E)-2,3-dibromobut-2-enedioate |
|---|---|
| PubChem CID | 11024798 |
| Molecular Formula | C8H8Br2O6 |
| Molecular Weight | 359.95 g/mol |
| Exact Mass | 357.87 |
| IUPAC Name | 4-O-(2-methoxy-2-oxoethyl) 1-O-methyl (E)-2,3-dibromobut-2-enedioate |
| SMILES | COC(=O)COC(=O)/C(Br)=C(\Br)C(=O)OC |
| InChI | InChI=1S/C8H8Br2O6/c1-14-4(11)3-16-8(13)6(10)5(9)7(12)15-2/h3H2,1-2H3/b6-5+ |
| InChIKey | KEASJBQRQACMKO-AATRIKPKSA-N |
| XLogP | 0.88 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.95 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|