C22H38N4O2 — CID 111241689
1-[2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethyl-3-[3-(3-methylpiperidin-1-yl)propyl]guanidine (PubChem CID 111241689) has the molecular formula C22H38N4O2 and a molecular weight of 390.57 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethyl-3-[3-(3-methylpiperidin-1-yl)propyl]guanidine.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethyl-3-[3-(3-methylpiperidin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111241689 |
| Molecular Formula | C22H38N4O2 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.30 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethyl-3-[3-(3-methylpiperidin-1-yl)propyl]guanidine |
| SMILES | C/N=C(\NCCCN1CCCC(C)C1)N(C)CCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C22H38N4O2/c1-18-8-6-13-26(17-18)14-7-12-24-22(23-2)25(3)15-11-19-9-10-20(27-4)21(16-19)28-5/h9-10,16,18H,6-8,11-15,17H2,1-5H3,(H,23,24) |
| InChIKey | URXXVBHLMRMWPG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|