C22H39N5O2 — CID 111240991
1-[2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine (PubChem CID 111240991) has the molecular formula C22H39N5O2 and a molecular weight of 405.59 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111240991 |
| Molecular Formula | C22H39N5O2 |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.31 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine |
| SMILES | C/N=C(/NCCCN1CCCN(C)CC1)N(C)CCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C22H39N5O2/c1-23-22(24-11-6-13-27-14-7-12-25(2)16-17-27)26(3)15-10-19-8-9-20(28-4)21(18-19)29-5/h8-9,18H,6-7,10-17H2,1-5H3,(H,23,24) |
| InChIKey | PVTJMURULAIYIT-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|