C23H42IN5O2 — CID 111241306
1-[2-(3,4-dimethoxyphenyl)ethyl]-3-ethyl-1-methyl-2-[4-(4-methylpiperazin-1-yl)butyl]guanidine;hydroiodide (PubChem CID 111241306) has the molecular formula C23H42IN5O2 and a molecular weight of 547.53 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-ethyl-1-methyl-2-[4-(4-methylpiperazin-1-yl)butyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-ethyl-1-methyl-2-[4-(4-methylpiperazin-1-yl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111241306 |
| Molecular Formula | C23H42IN5O2 |
| Molecular Weight | 547.53 g/mol |
| Exact Mass | 547.24 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-ethyl-1-methyl-2-[4-(4-methylpiperazin-1-yl)butyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCCN1CCN(C)CC1)N(C)CCc1ccc(OC)c(OC)c1.I |
| InChI | InChI=1S/C23H41N5O2.HI/c1-6-24-23(25-12-7-8-13-28-17-15-26(2)16-18-28)27(3)14-11-20-9-10-21(29-4)22(19-20)30-5;/h9-10,19H,6-8,11-18H2,1-5H3,(H,24,25);1H |
| InChIKey | ZYGIJSZUTXFPMQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.53 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|