C21H34IN5O2 — CID 111241840
1-[2-(3,4-dimethoxyphenyl)ethyl]-3-ethyl-1-methyl-2-[3-(4-methylpyrazol-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111241840) has the molecular formula C21H34IN5O2 and a molecular weight of 515.44 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-ethyl-1-methyl-2-[3-(4-methylpyrazol-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-ethyl-1-methyl-2-[3-(4-methylpyrazol-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111241840 |
| Molecular Formula | C21H34IN5O2 |
| Molecular Weight | 515.44 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-ethyl-1-methyl-2-[3-(4-methylpyrazol-1-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCn1cc(C)cn1)N(C)CCc1ccc(OC)c(OC)c1.I |
| InChI | InChI=1S/C21H33N5O2.HI/c1-6-22-21(23-11-7-12-26-16-17(2)15-24-26)25(3)13-10-18-8-9-19(27-4)20(14-18)28-5;/h8-9,14-16H,6-7,10-13H2,1-5H3,(H,22,23);1H |
| InChIKey | GFZOIHOCKHLALR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 63.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|