C17H30IN3O2 — CID 111574964
2-[3-(3-ethoxy-4-methoxyphenyl)propyl]-3-ethyl-1,1-dimethylguanidine;hydroiodide (PubChem CID 111574964) has the molecular formula C17H30IN3O2 and a molecular weight of 435.35 g/mol. Its IUPAC name is 2-[3-(3-ethoxy-4-methoxyphenyl)propyl]-3-ethyl-1,1-dimethylguanidine;hydroiodide.
| Compound Name | 2-[3-(3-ethoxy-4-methoxyphenyl)propyl]-3-ethyl-1,1-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111574964 |
| Molecular Formula | C17H30IN3O2 |
| Molecular Weight | 435.35 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 2-[3-(3-ethoxy-4-methoxyphenyl)propyl]-3-ethyl-1,1-dimethylguanidine;hydroiodide |
| SMILES | CCN/C(=N/CCCc1ccc(OC)c(OCC)c1)N(C)C.I |
| InChI | InChI=1S/C17H29N3O2.HI/c1-6-18-17(20(3)4)19-12-8-9-14-10-11-15(21-5)16(13-14)22-7-2;/h10-11,13H,6-9,12H2,1-5H3,(H,18,19);1H |
| InChIKey | DPFUBBMSVXMECU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|