C24H36IN3O5 — CID 111827808
2-[3-(3-ethoxy-4-methoxyphenyl)propyl]-1-ethyl-3-(3,4,5-trimethoxyphenyl)guanidine;hydroiodide (PubChem CID 111827808) has the molecular formula C24H36IN3O5 and a molecular weight of 573.47 g/mol. Its IUPAC name is 2-[3-(3-ethoxy-4-methoxyphenyl)propyl]-1-ethyl-3-(3,4,5-trimethoxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-[3-(3-ethoxy-4-methoxyphenyl)propyl]-1-ethyl-3-(3,4,5-trimethoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111827808 |
| Molecular Formula | C24H36IN3O5 |
| Molecular Weight | 573.47 g/mol |
| Exact Mass | 573.17 |
| IUPAC Name | 2-[3-(3-ethoxy-4-methoxyphenyl)propyl]-1-ethyl-3-(3,4,5-trimethoxyphenyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCc1ccc(OC)c(OCC)c1)Nc1cc(OC)c(OC)c(OC)c1.I |
| InChI | InChI=1S/C24H35N3O5.HI/c1-7-25-24(27-18-15-21(29-4)23(31-6)22(16-18)30-5)26-13-9-10-17-11-12-19(28-3)20(14-17)32-8-2;/h11-12,14-16H,7-10,13H2,1-6H3,(H2,25,26,27);1H |
| InChIKey | UBMJRYROIBITGF-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.47 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|