C22H38IN3O3 — CID 111240980
2-(3-cyclopentyloxypropyl)-1-[2-(3,4-dimethoxyphenyl)ethyl]-3-ethyl-1-methylguanidine;hydroiodide (PubChem CID 111240980) has the molecular formula C22H38IN3O3 and a molecular weight of 519.47 g/mol. Its IUPAC name is 2-(3-cyclopentyloxypropyl)-1-[2-(3,4-dimethoxyphenyl)ethyl]-3-ethyl-1-methylguanidine;hydroiodide.
| Compound Name | 2-(3-cyclopentyloxypropyl)-1-[2-(3,4-dimethoxyphenyl)ethyl]-3-ethyl-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111240980 |
| Molecular Formula | C22H38IN3O3 |
| Molecular Weight | 519.47 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | 2-(3-cyclopentyloxypropyl)-1-[2-(3,4-dimethoxyphenyl)ethyl]-3-ethyl-1-methylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCOC1CCCC1)N(C)CCc1ccc(OC)c(OC)c1.I |
| InChI | InChI=1S/C22H37N3O3.HI/c1-5-23-22(24-14-8-16-28-19-9-6-7-10-19)25(2)15-13-18-11-12-20(26-3)21(17-18)27-4;/h11-12,17,19H,5-10,13-16H2,1-4H3,(H,23,24);1H |
| InChIKey | YBLYGTIIDNUIOD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|